C25H26F2N6OS — CID 54052191
1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-1-ol (PubChem CID 54052191) has the molecular formula C25H26F2N6OS and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-1-ol.
| Compound Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 54052191 |
| Molecular Formula | C25H26F2N6OS |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-1-ol |
| SMILES | OC(CCSc1ncnc2nc[nH]c12)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H26F2N6OS/c26-19-5-1-17(2-6-19)23(18-3-7-20(27)8-4-18)33-12-10-32(11-13-33)21(34)9-14-35-25-22-24(29-15-28-22)30-16-31-25/h1-8,15-16,21,23,34H,9-14H2,(H,28,29,30,31) |
| InChIKey | LTROTEVFAQQYES-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |