C10H8N8S2 — CID 91596176
8-(7H-purin-6-ylsulfanyl)-3,7,8,9-tetrahydropurine-2-thione (PubChem CID 91596176) has the molecular formula C10H8N8S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 8-(7H-purin-6-ylsulfanyl)-3,7,8,9-tetrahydropurine-2-thione.
| Compound Name | 8-(7H-purin-6-ylsulfanyl)-3,7,8,9-tetrahydropurine-2-thione |
|---|---|
| PubChem CID | 91596176 |
| Molecular Formula | C10H8N8S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 8-(7H-purin-6-ylsulfanyl)-3,7,8,9-tetrahydropurine-2-thione |
| SMILES | S=c1ncc2c([nH]1)NC(Sc1ncnc3nc[nH]c13)N2 |
| InChI | InChI=1S/C10H8N8S2/c19-9-11-1-4-6(17-9)18-10(16-4)20-8-5-7(13-2-12-5)14-3-15-8/h1-3,10,16H,(H2,11,17,18,19)(H,12,13,14,15) |
| InChIKey | SHXRIJZBNCZCRF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|