C8H7N4O2S- — CID 7644850
(2R)-2-(7H-purin-6-ylsulfanyl)propanoate (PubChem CID 7644850) has the molecular formula C8H7N4O2S- and a molecular weight of 223.24 g/mol. Its IUPAC name is (2R)-2-(7H-purin-6-ylsulfanyl)propanoate.
| Compound Name | (2R)-2-(7H-purin-6-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 7644850 |
| Molecular Formula | C8H7N4O2S- |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | (2R)-2-(7H-purin-6-ylsulfanyl)propanoate |
| SMILES | C[C@@H](Sc1ncnc2nc[nH]c12)C(=O)[O-] |
| InChI | InChI=1S/C8H8N4O2S/c1-4(8(13)14)15-7-5-6(10-2-9-5)11-3-12-7/h2-4H,1H3,(H,13,14)(H,9,10,11,12)/p-1/t4-/m1/s1 |
| InChIKey | IZWZDXLHEAFSGF-SCSAIBSYSA-M |
| XLogP | -0.42 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |