C16H15N5O2S — CID 23101869
N-(4-acetylphenyl)-2-(7H-purin-6-ylsulfanyl)propanamide (PubChem CID 23101869) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(7H-purin-6-ylsulfanyl)propanamide.
| Compound Name | N-(4-acetylphenyl)-2-(7H-purin-6-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 23101869 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(4-acetylphenyl)-2-(7H-purin-6-ylsulfanyl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)Sc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C16H15N5O2S/c1-9(22)11-3-5-12(6-4-11)21-15(23)10(2)24-16-13-14(18-7-17-13)19-8-20-16/h3-8,10H,1-2H3,(H,21,23)(H,17,18,19,20) |
| InChIKey | FGKQBZUFCZBQAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |