C14H17N7OS — CID 124566871
(2S)-N-(2-propan-2-ylpyrazol-3-yl)-2-(7H-purin-6-ylsulfanyl)propanamide (PubChem CID 124566871) has the molecular formula C14H17N7OS and a molecular weight of 331.41 g/mol. Its IUPAC name is (2S)-N-(2-propan-2-ylpyrazol-3-yl)-2-(7H-purin-6-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-propan-2-ylpyrazol-3-yl)-2-(7H-purin-6-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 124566871 |
| Molecular Formula | C14H17N7OS |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2S)-N-(2-propan-2-ylpyrazol-3-yl)-2-(7H-purin-6-ylsulfanyl)propanamide |
| SMILES | CC(C)n1nccc1NC(=O)[C@H](C)Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H17N7OS/c1-8(2)21-10(4-5-19-21)20-13(22)9(3)23-14-11-12(16-6-15-11)17-7-18-14/h4-9H,1-3H3,(H,20,22)(H,15,16,17,18)/t9-/m0/s1 |
| InChIKey | LYIYZQHGSKYBEI-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |