C14H12ClN5OS — CID 41063647
(2S)-N-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanyl)propanamide (PubChem CID 41063647) has the molecular formula C14H12ClN5OS and a molecular weight of 333.80 g/mol. Its IUPAC name is (2S)-N-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 41063647 |
| Molecular Formula | C14H12ClN5OS |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (2S)-N-(2-chlorophenyl)-2-(7H-purin-6-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1ncnc2nc[nH]c12)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H12ClN5OS/c1-8(13(21)20-10-5-3-2-4-9(10)15)22-14-11-12(17-6-16-11)18-7-19-14/h2-8H,1H3,(H,20,21)(H,16,17,18,19)/t8-/m0/s1 |
| InChIKey | WIIGWXMRCKOZBL-QMMMGPOBSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |