C20H14F3N5OS — CID 19059021
2-phenyl-2-(7H-purin-6-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 19059021) has the molecular formula C20H14F3N5OS and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-phenyl-2-(7H-purin-6-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-phenyl-2-(7H-purin-6-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19059021 |
| Molecular Formula | C20H14F3N5OS |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-phenyl-2-(7H-purin-6-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C(Sc1ncnc2nc[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C20H14F3N5OS/c21-20(22,23)13-8-4-5-9-14(13)28-18(29)16(12-6-2-1-3-7-12)30-19-15-17(25-10-24-15)26-11-27-19/h1-11,16H,(H,28,29)(H,24,25,26,27) |
| InChIKey | NRBZHTTXCTVXDG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |