C12H15N5O2S — CID 79653954
1-(methylamino)-3-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid (PubChem CID 79653954) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(methylamino)-3-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(methylamino)-3-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79653954 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(methylamino)-3-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid |
| SMILES | CNC1(C(=O)O)CCC(Sc2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C12H15N5O2S/c1-13-12(11(18)19)3-2-7(4-12)20-10-8-9(15-5-14-8)16-6-17-10/h5-7,13H,2-4H2,1H3,(H,18,19)(H,14,15,16,17) |
| InChIKey | GZXDMLIKSYSXLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |