C12H16BrN3OS — CID 79656899
3-[(3-bromo-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxamide (PubChem CID 79656899) has the molecular formula C12H16BrN3OS and a molecular weight of 330.25 g/mol. Its IUPAC name is 3-[(3-bromo-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxamide.
| Compound Name | 3-[(3-bromo-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79656899 |
| Molecular Formula | C12H16BrN3OS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[(3-bromo-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCC(Sc2ncccc2Br)C1 |
| InChI | InChI=1S/C12H16BrN3OS/c1-15-12(11(14)17)5-4-8(7-12)18-10-9(13)3-2-6-16-10/h2-3,6,8,15H,4-5,7H2,1H3,(H2,14,17) |
| InChIKey | ZRSXJTAFYLBDFZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |