C15H22N2O2S — CID 79654009
ethyl 1-(ethylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylate (PubChem CID 79654009) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is ethyl 1-(ethylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(ethylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79654009 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | ethyl 1-(ethylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylate |
| SMILES | CCNC1(C(=O)OCC)CCC(Sc2ccccn2)C1 |
| InChI | InChI=1S/C15H22N2O2S/c1-3-17-15(14(18)19-4-2)9-8-12(11-15)20-13-7-5-6-10-16-13/h5-7,10,12,17H,3-4,8-9,11H2,1-2H3 |
| InChIKey | QJZUQGFVGFZJFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |