C14H18N2O2S — CID 79654393
1-(cyclopropylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylic acid (PubChem CID 79654393) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylic acid.
| Compound Name | 1-(cyclopropylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79654393 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(cyclopropylamino)-3-pyridin-2-ylsulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CC2)CCC(Sc2ccccn2)C1 |
| InChI | InChI=1S/C14H18N2O2S/c17-13(18)14(16-10-4-5-10)7-6-11(9-14)19-12-3-1-2-8-15-12/h1-3,8,10-11,16H,4-7,9H2,(H,17,18) |
| InChIKey | PZUZXMKDORGYMF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |