C12H17N3O2S — CID 79654095
methyl 1-(methylamino)-3-pyrimidin-2-ylsulfanylcyclopentane-1-carboxylate (PubChem CID 79654095) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 1-(methylamino)-3-pyrimidin-2-ylsulfanylcyclopentane-1-carboxylate.
| Compound Name | methyl 1-(methylamino)-3-pyrimidin-2-ylsulfanylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79654095 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 1-(methylamino)-3-pyrimidin-2-ylsulfanylcyclopentane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCC(Sc2ncccn2)C1 |
| InChI | InChI=1S/C12H17N3O2S/c1-13-12(10(16)17-2)5-4-9(8-12)18-11-14-6-3-7-15-11/h3,6-7,9,13H,4-5,8H2,1-2H3 |
| InChIKey | UGBFMOARERTNPG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |