C13H18N2O2S2 — CID 79654258
methyl 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclopentane-1-carboxylate (PubChem CID 79654258) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is methyl 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79654258 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | methyl 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC2CC2)CCC(Sc2nccs2)C1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-17-11(16)13(15-9-2-3-9)5-4-10(8-13)19-12-14-6-7-18-12/h6-7,9-10,15H,2-5,8H2,1H3 |
| InChIKey | ZYTYDTGDFUKLIH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|