C13H19N3OS2 — CID 79635302
1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclohexane-1-carboxamide (PubChem CID 79635302) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79635302 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-(cyclopropylamino)-3-(1,3-thiazol-2-ylsulfanyl)cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(NC2CC2)CCCC(Sc2nccs2)C1 |
| InChI | InChI=1S/C13H19N3OS2/c14-11(17)13(16-9-3-4-9)5-1-2-10(8-13)19-12-15-6-7-18-12/h6-7,9-10,16H,1-5,8H2,(H2,14,17) |
| InChIKey | JQNYNJXEBQXDNL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|