C16H20ClNO2S — CID 114791652
3-[(4-chlorophenyl)methylsulfanyl]-1-(cyclopropylamino)cyclopentane-1-carboxylic acid (PubChem CID 114791652) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-1-(cyclopropylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-1-(cyclopropylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114791652 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-1-(cyclopropylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CC2)CCC(SCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H20ClNO2S/c17-12-3-1-11(2-4-12)10-21-14-7-8-16(9-14,15(19)20)18-13-5-6-13/h1-4,13-14,18H,5-10H2,(H,19,20) |
| InChIKey | IYVIUEVREXLDQJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |