C14H19ClN2O2S — CID 79656323
ethyl 3-[(5-chloro-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxylate (PubChem CID 79656323) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-[(5-chloro-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79656323 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | ethyl 3-[(5-chloro-2-pyridinyl)sulfanyl]-1-(methylamino)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC)CCC(Sc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-3-19-13(18)14(16-2)7-6-11(8-14)20-12-5-4-10(15)9-17-12/h4-5,9,11,16H,3,6-8H2,1-2H3 |
| InChIKey | MUBOCMAUEJVGHM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |