C11H14BrNOS — CID 102732838
trans-(1R,2R)-2-[(3-bromo-2-pyridinyl)sulfanyl]cyclohexan-1-ol (PubChem CID 102732838) has the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(3-bromo-2-pyridinyl)sulfanyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[(3-bromo-2-pyridinyl)sulfanyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732838 |
| Molecular Formula | C11H14BrNOS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | trans-(1R,2R)-2-[(3-bromo-2-pyridinyl)sulfanyl]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Sc1ncccc1Br |
| InChI | InChI=1S/C11H14BrNOS/c12-8-4-3-7-13-11(8)15-10-6-2-1-5-9(10)14/h3-4,7,9-10,14H,1-2,5-6H2/t9-,10-/m1/s1 |
| InChIKey | GOZLNXHPAYSNQN-NXEZZACHSA-N |
| XLogP | 3.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |