C10H13NOS — CID 102735784
trans-(1S,2S)-2-pyridin-4-ylsulfanylcyclopentan-1-ol (PubChem CID 102735784) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is trans-(1S,2S)-2-pyridin-4-ylsulfanylcyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-pyridin-4-ylsulfanylcyclopentan-1-ol |
|---|---|
| PubChem CID | 102735784 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | trans-(1S,2S)-2-pyridin-4-ylsulfanylcyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Sc1ccncc1 |
| InChI | InChI=1S/C10H13NOS/c12-9-2-1-3-10(9)13-8-4-6-11-7-5-8/h4-7,9-10,12H,1-3H2/t9-,10-/m0/s1 |
| InChIKey | FPVKXTJXEPZIQG-UWVGGRQHSA-N |
| XLogP | 2.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |