About 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol
3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol (PubChem CID 102735808) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol |
| PubChem CID | 102735808 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol |
| SMILES | Oc1cccc(S[C@@H]2CCC[C@H]2O)c1 |
| InChI | InChI=1S/C11H14O2S/c12-8-3-1-4-9(7-8)14-11-6-2-5-10(11)13/h1,3-4,7,10-13H,2,5-6H2/t10-,11-/m1/s1 |
| InChIKey | HHTLNHUYKQGZJY-GHMZBOCLSA-N |
| XLogP | 2.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol?
The IUPAC name of 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol (CID 102735808) is 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol.
What is the SMILES notation for 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol?
The canonical SMILES for 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol is Oc1cccc(S[C@@H]2CCC[C@H]2O)c1.
What is the InChIKey of 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol?
The InChIKey is HHTLNHUYKQGZJY-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H14O2S/c12-8-3-1-4-9(7-8)14-11-6-2-5-10(11)13/h1,3-4,7,10-13H,2,5-6H2/t10-,11-/m1/s1.
What are the key properties of 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol?
3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol has a molecular weight of 210.30 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-hydroxycyclopentyl]sulfanylphenol is sourced from PubChem (CID 102735808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).