C8H11NOS2 — CID 102735696
trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol (PubChem CID 102735696) has the molecular formula C8H11NOS2 and a molecular weight of 201.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735696 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Sc1nccs1 |
| InChI | InChI=1S/C8H11NOS2/c10-6-2-1-3-7(6)12-8-9-4-5-11-8/h4-7,10H,1-3H2/t6-,7-/m0/s1 |
| InChIKey | LXMGYIMNMGUGCB-BQBZGAKWSA-N |
| XLogP | 2.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|