About trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol
trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol (PubChem CID 102735696) has the molecular formula C8H11NOS2
and a molecular weight of 201.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol |
| PubChem CID | 102735696 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Sc1nccs1 |
| InChI | InChI=1S/C8H11NOS2/c10-6-2-1-3-7(6)12-8-9-4-5-11-8/h4-7,10H,1-3H2/t6-,7-/m0/s1 |
| InChIKey | LXMGYIMNMGUGCB-BQBZGAKWSA-N |
| XLogP | 2.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol?
The IUPAC name of trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol (CID 102735696) is trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol.
What is the SMILES notation for trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol?
The canonical SMILES for trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol is O[C@H]1CCC[C@@H]1Sc1nccs1.
What is the InChIKey of trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol?
The InChIKey is LXMGYIMNMGUGCB-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H11NOS2/c10-6-2-1-3-7(6)12-8-9-4-5-11-8/h4-7,10H,1-3H2/t6-,7-/m0/s1.
What are the key properties of trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol?
trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol has a molecular weight of 201.32 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(1,3-thiazol-2-ylsulfanyl)cyclopentan-1-ol is sourced from PubChem (CID 102735696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).