C11H12N4O2S — CID 63098084
2-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid (PubChem CID 63098084) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 63098084 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(7H-purin-6-ylsulfanyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H12N4O2S/c16-11(17)6-2-1-3-7(6)18-10-8-9(13-4-12-8)14-5-15-10/h4-7H,1-3H2,(H,16,17)(H,12,13,14,15) |
| InChIKey | SPFUAJCAEPODBP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |