C11H9N7S — CID 115490148
5-(7H-purin-6-ylsulfanyl)pyridine-2-carboximidamide (PubChem CID 115490148) has the molecular formula C11H9N7S and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-(7H-purin-6-ylsulfanyl)pyridine-2-carboximidamide.
| Compound Name | 5-(7H-purin-6-ylsulfanyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 115490148 |
| Molecular Formula | C11H9N7S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-(7H-purin-6-ylsulfanyl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ncnc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C11H9N7S/c12-9(13)7-2-1-6(3-14-7)19-11-8-10(16-4-15-8)17-5-18-11/h1-5H,(H3,12,13)(H,15,16,17,18) |
| InChIKey | HZGMKBBUBHHMTM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|