C8H7N5S2 — CID 115490181
5-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-2-carboximidamide (PubChem CID 115490181) has the molecular formula C8H7N5S2 and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-2-carboximidamide.
| Compound Name | 5-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 115490181 |
| Molecular Formula | C8H7N5S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 5-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ncns2)cn1 |
| InChI | InChI=1S/C8H7N5S2/c9-7(10)6-2-1-5(3-11-6)14-8-12-4-13-15-8/h1-4H,(H3,9,10) |
| InChIKey | HJCXUZCNLYSQSA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|