C12H9Cl2N3S — CID 112736289
5-(3,5-dichlorophenyl)sulfanylpyridine-2-carboximidamide (PubChem CID 112736289) has the molecular formula C12H9Cl2N3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)sulfanylpyridine-2-carboximidamide.
| Compound Name | 5-(3,5-dichlorophenyl)sulfanylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 112736289 |
| Molecular Formula | C12H9Cl2N3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 5-(3,5-dichlorophenyl)sulfanylpyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C12H9Cl2N3S/c13-7-3-8(14)5-10(4-7)18-9-1-2-11(12(15)16)17-6-9/h1-6H,(H3,15,16) |
| InChIKey | RFOKYVVHAYGDNR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|