C11H9N7OS — CID 114409591
5-amino-6-(7H-purin-6-ylsulfanyl)pyridine-2-carboxamide (PubChem CID 114409591) has the molecular formula C11H9N7OS and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-amino-6-(7H-purin-6-ylsulfanyl)pyridine-2-carboxamide.
| Compound Name | 5-amino-6-(7H-purin-6-ylsulfanyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114409591 |
| Molecular Formula | C11H9N7OS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-amino-6-(7H-purin-6-ylsulfanyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N)c(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H9N7OS/c12-5-1-2-6(8(13)19)18-10(5)20-11-7-9(15-3-14-7)16-4-17-11/h1-4H,12H2,(H2,13,19)(H,14,15,16,17) |
| InChIKey | FLBKVGKOVUZKHS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |