C12H10N6OS — CID 62255044
2-amino-5-(7H-purin-6-ylsulfanyl)benzamide (PubChem CID 62255044) has the molecular formula C12H10N6OS and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-amino-5-(7H-purin-6-ylsulfanyl)benzamide.
| Compound Name | 2-amino-5-(7H-purin-6-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 62255044 |
| Molecular Formula | C12H10N6OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-amino-5-(7H-purin-6-ylsulfanyl)benzamide |
| SMILES | NC(=O)c1cc(Sc2ncnc3nc[nH]c23)ccc1N |
| InChI | InChI=1S/C12H10N6OS/c13-8-2-1-6(3-7(8)10(14)19)20-12-9-11(16-4-15-9)17-5-18-12/h1-5H,13H2,(H2,14,19)(H,15,16,17,18) |
| InChIKey | OOLPBGYLOXXVOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|