C13H14N6S — CID 103938174
(1S)-1-[5-(7H-purin-6-ylsulfanyl)-2-pyridinyl]propan-1-amine (PubChem CID 103938174) has the molecular formula C13H14N6S and a molecular weight of 286.36 g/mol. Its IUPAC name is (1S)-1-[5-(7H-purin-6-ylsulfanyl)-2-pyridinyl]propan-1-amine.
| Compound Name | (1S)-1-[5-(7H-purin-6-ylsulfanyl)-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 103938174 |
| Molecular Formula | C13H14N6S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1S)-1-[5-(7H-purin-6-ylsulfanyl)-2-pyridinyl]propan-1-amine |
| SMILES | CC[C@H](N)c1ccc(Sc2ncnc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C13H14N6S/c1-2-9(14)10-4-3-8(5-15-10)20-13-11-12(17-6-16-11)18-7-19-13/h3-7,9H,2,14H2,1H3,(H,16,17,18,19)/t9-/m0/s1 |
| InChIKey | BFJFNRXTMQBMHP-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |