C10H14N6S — CID 103938080
(1R)-1-[5-(1-methyltetrazol-5-yl)sulfanyl-2-pyridinyl]propan-1-amine (PubChem CID 103938080) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is (1R)-1-[5-(1-methyltetrazol-5-yl)sulfanyl-2-pyridinyl]propan-1-amine.
| Compound Name | (1R)-1-[5-(1-methyltetrazol-5-yl)sulfanyl-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 103938080 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1R)-1-[5-(1-methyltetrazol-5-yl)sulfanyl-2-pyridinyl]propan-1-amine |
| SMILES | CC[C@@H](N)c1ccc(Sc2nnnn2C)cn1 |
| InChI | InChI=1S/C10H14N6S/c1-3-8(11)9-5-4-7(6-12-9)17-10-13-14-15-16(10)2/h4-6,8H,3,11H2,1-2H3/t8-/m1/s1 |
| InChIKey | UOOWEYUHNPEIOP-MRVPVSSYSA-N |
| XLogP | 1.17 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |