C12H7BrN4O2S — CID 114888782
2-bromo-6-(7H-purin-6-ylsulfanyl)benzoic acid (PubChem CID 114888782) has the molecular formula C12H7BrN4O2S and a molecular weight of 351.19 g/mol. Its IUPAC name is 2-bromo-6-(7H-purin-6-ylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-6-(7H-purin-6-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 114888782 |
| Molecular Formula | C12H7BrN4O2S |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2-bromo-6-(7H-purin-6-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1c(Br)cccc1Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H7BrN4O2S/c13-6-2-1-3-7(8(6)12(18)19)20-11-9-10(15-4-14-9)16-5-17-11/h1-5H,(H,18,19)(H,14,15,16,17) |
| InChIKey | BBPIWRXBYNCLEE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |