C11H6ClN5O2S — CID 62253225
2-chloro-6-(7H-purin-6-ylsulfanyl)pyridine-4-carboxylic acid (PubChem CID 62253225) has the molecular formula C11H6ClN5O2S and a molecular weight of 307.72 g/mol. Its IUPAC name is 2-chloro-6-(7H-purin-6-ylsulfanyl)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(7H-purin-6-ylsulfanyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 62253225 |
| Molecular Formula | C11H6ClN5O2S |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-chloro-6-(7H-purin-6-ylsulfanyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(Sc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C11H6ClN5O2S/c12-6-1-5(11(18)19)2-7(17-6)20-10-8-9(14-3-13-8)15-4-16-10/h1-4H,(H,18,19)(H,13,14,15,16) |
| InChIKey | CIKJRSMRYXIOFU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|