C9H7ClN4O2S — CID 104602659
2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboxylic acid (PubChem CID 104602659) has the molecular formula C9H7ClN4O2S and a molecular weight of 270.70 g/mol. Its IUPAC name is 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 104602659 |
| Molecular Formula | C9H7ClN4O2S |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridine-4-carboxylic acid |
| SMILES | Cn1ncnc1Sc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C9H7ClN4O2S/c1-14-9(11-4-12-14)17-7-3-5(8(15)16)2-6(10)13-7/h2-4H,1H3,(H,15,16) |
| InChIKey | QDCWYZHZQIHIEI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|