C10H7ClN2O2S2 — CID 43166625
2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid (PubChem CID 43166625) has the molecular formula C10H7ClN2O2S2 and a molecular weight of 286.77 g/mol. Its IUPAC name is 2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43166625 |
| Molecular Formula | C10H7ClN2O2S2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid |
| SMILES | Cc1csc(Sc2cc(C(=O)O)cc(Cl)n2)n1 |
| InChI | InChI=1S/C10H7ClN2O2S2/c1-5-4-16-10(12-5)17-8-3-6(9(14)15)2-7(11)13-8/h2-4H,1H3,(H,14,15) |
| InChIKey | AWJHZNAYDVCJQB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|