C9H6ClN3O3S — CID 62253629
2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid (PubChem CID 62253629) has the molecular formula C9H6ClN3O3S and a molecular weight of 271.69 g/mol. Its IUPAC name is 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 62253629 |
| Molecular Formula | C9H6ClN3O3S |
| Molecular Weight | 271.69 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]pyridine-4-carboxylic acid |
| SMILES | Cc1nnc(Sc2cc(C(=O)O)cc(Cl)n2)o1 |
| InChI | InChI=1S/C9H6ClN3O3S/c1-4-12-13-9(16-4)17-7-3-5(8(14)15)2-6(10)11-7/h2-3H,1H3,(H,14,15) |
| InChIKey | VSDHKQONJDMSFL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|