C10H10N8S — CID 80922991
[2-methyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-yl]hydrazine (PubChem CID 80922991) has the molecular formula C10H10N8S and a molecular weight of 274.31 g/mol. Its IUPAC name is [2-methyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80922991 |
| Molecular Formula | C10H10N8S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [2-methyl-6-(7H-purin-6-ylsulfanyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(Sc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C10H10N8S/c1-5-16-6(18-11)2-7(17-5)19-10-8-9(13-3-12-8)14-4-15-10/h2-4H,11H2,1H3,(H,16,17,18)(H,12,13,14,15) |
| InChIKey | VBDDJGCHWMRWAH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|