About 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine
6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine (PubChem CID 114072791) has the molecular formula C10H4F3N5S
and a molecular weight of 283.24 g/mol. Its IUPAC name is 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine.
Molecular Properties
| Compound Name | 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine |
| PubChem CID | 114072791 |
| Molecular Formula | C10H4F3N5S |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine |
| SMILES | Fc1cc(F)c(Sc2ncnc3nc[nH]c23)nc1F |
| InChI | InChI=1S/C10H4F3N5S/c11-4-1-5(12)9(18-7(4)13)19-10-6-8(15-2-14-6)16-3-17-10/h1-3H,(H,14,15,16,17) |
| InChIKey | LXRRIZBKBCIKJO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine?
The IUPAC name of 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine (CID 114072791) is 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine.
What is the SMILES notation for 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine?
The canonical SMILES for 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine is Fc1cc(F)c(Sc2ncnc3nc[nH]c23)nc1F.
What is the InChIKey of 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine?
The InChIKey is LXRRIZBKBCIKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F3N5S/c11-4-1-5(12)9(18-7(4)13)19-10-6-8(15-2-14-6)16-3-17-10/h1-3H,(H,14,15,16,17).
What are the key properties of 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine?
6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine has a molecular weight of 283.24 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-7H-purine is sourced from PubChem (CID 114072791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).