C12H10FN5OS — CID 63600025
5-fluoro-4-methoxy-2-(7H-purin-6-ylsulfanyl)aniline (PubChem CID 63600025) has the molecular formula C12H10FN5OS and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-2-(7H-purin-6-ylsulfanyl)aniline.
| Compound Name | 5-fluoro-4-methoxy-2-(7H-purin-6-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 63600025 |
| Molecular Formula | C12H10FN5OS |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-fluoro-4-methoxy-2-(7H-purin-6-ylsulfanyl)aniline |
| SMILES | COc1cc(Sc2ncnc3nc[nH]c23)c(N)cc1F |
| InChI | InChI=1S/C12H10FN5OS/c1-19-8-3-9(7(14)2-6(8)13)20-12-10-11(16-4-15-10)17-5-18-12/h2-5H,14H2,1H3,(H,15,16,17,18) |
| InChIKey | FOROSDDQAFGOIX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|