C13H11FN4OS — CID 63835945
(1R)-1-[3-fluoro-4-(7H-purin-6-ylsulfanyl)phenyl]ethanol (PubChem CID 63835945) has the molecular formula C13H11FN4OS and a molecular weight of 290.32 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-4-(7H-purin-6-ylsulfanyl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-fluoro-4-(7H-purin-6-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 63835945 |
| Molecular Formula | C13H11FN4OS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (1R)-1-[3-fluoro-4-(7H-purin-6-ylsulfanyl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Sc2ncnc3nc[nH]c23)c(F)c1 |
| InChI | InChI=1S/C13H11FN4OS/c1-7(19)8-2-3-10(9(14)4-8)20-13-11-12(16-5-15-11)17-6-18-13/h2-7,19H,1H3,(H,15,16,17,18)/t7-/m1/s1 |
| InChIKey | WVLAUHDAEGAUHY-SSDOTTSWSA-N |
| XLogP | 2.70 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |