C11H7F2N5O — CID 63598478
2,5-difluoro-4-(7H-purin-6-yloxy)aniline (PubChem CID 63598478) has the molecular formula C11H7F2N5O and a molecular weight of 263.21 g/mol. Its IUPAC name is 2,5-difluoro-4-(7H-purin-6-yloxy)aniline.
| Compound Name | 2,5-difluoro-4-(7H-purin-6-yloxy)aniline |
|---|---|
| PubChem CID | 63598478 |
| Molecular Formula | C11H7F2N5O |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,5-difluoro-4-(7H-purin-6-yloxy)aniline |
| SMILES | Nc1cc(F)c(Oc2ncnc3nc[nH]c23)cc1F |
| InChI | InChI=1S/C11H7F2N5O/c12-5-2-8(6(13)1-7(5)14)19-11-9-10(16-3-15-9)17-4-18-11/h1-4H,14H2,(H,15,16,17,18) |
| InChIKey | NGQUIRIECSXEMX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|