C14H11F2N3OS — CID 63599367
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxy-2,5-difluoroaniline (PubChem CID 63599367) has the molecular formula C14H11F2N3OS and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxy-2,5-difluoroaniline.
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxy-2,5-difluoroaniline |
|---|---|
| PubChem CID | 63599367 |
| Molecular Formula | C14H11F2N3OS |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxy-2,5-difluoroaniline |
| SMILES | Cc1sc2ncnc(Oc3cc(F)c(N)cc3F)c2c1C |
| InChI | InChI=1S/C14H11F2N3OS/c1-6-7(2)21-14-12(6)13(18-5-19-14)20-11-4-8(15)10(17)3-9(11)16/h3-5H,17H2,1-2H3 |
| InChIKey | IAXOZJLVRJRISX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|