C8H12N8OS — CID 123620501
4-(hexazinanyloxy)-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 123620501) has the molecular formula C8H12N8OS and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-(hexazinanyloxy)-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(hexazinanyloxy)-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 123620501 |
| Molecular Formula | C8H12N8OS |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(hexazinanyloxy)-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2ncnc(ON3NNNNN3)c2c1C |
| InChI | InChI=1S/C8H12N8OS/c1-4-5(2)18-8-6(4)7(9-3-10-8)17-16-14-12-11-13-15-16/h3,11-15H,1-2H3 |
| InChIKey | PRUHLSWLHKIGBT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |