C14H12N2O2S — CID 60870662
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxyphenol (PubChem CID 60870662) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxyphenol.
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxyphenol |
|---|---|
| PubChem CID | 60870662 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxyphenol |
| SMILES | Cc1sc2ncnc(Oc3ccc(O)cc3)c2c1C |
| InChI | InChI=1S/C14H12N2O2S/c1-8-9(2)19-14-12(8)13(15-7-16-14)18-11-5-3-10(17)4-6-11/h3-7,17H,1-2H3 |
| InChIKey | RZSOFRWAXJUVGQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |