C15H12ClN3O2S — CID 9251119
5-chloro-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide (PubChem CID 9251119) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is 5-chloro-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
| Compound Name | 5-chloro-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
|---|---|
| PubChem CID | 9251119 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 5-chloro-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| SMILES | Cc1sc2ncnc(Oc3ccc(Cl)cc3C(N)=O)c2c1C |
| InChI | InChI=1S/C15H12ClN3O2S/c1-7-8(2)22-15-12(7)14(18-6-19-15)21-11-4-3-9(16)5-10(11)13(17)20/h3-6H,1-2H3,(H2,17,20) |
| InChIKey | GBHBRPCRLDJJSN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |