C19H12ClN3O2S — CID 9251131
5-chloro-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide (PubChem CID 9251131) has the molecular formula C19H12ClN3O2S and a molecular weight of 381.84 g/mol. Its IUPAC name is 5-chloro-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
| Compound Name | 5-chloro-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
|---|---|
| PubChem CID | 9251131 |
| Molecular Formula | C19H12ClN3O2S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 5-chloro-2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1Oc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H12ClN3O2S/c20-12-6-7-15(13(8-12)17(21)24)25-18-14-9-16(11-4-2-1-3-5-11)26-19(14)23-10-22-18/h1-10H,(H2,21,24) |
| InChIKey | MPRXQIYWCWRMQG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |