C10H6F2IN3O2 — CID 114578763
4-(4-amino-2,5-difluorophenoxy)-5-iodo-1H-pyrimidin-6-one (PubChem CID 114578763) has the molecular formula C10H6F2IN3O2 and a molecular weight of 365.08 g/mol. Its IUPAC name is 4-(4-amino-2,5-difluorophenoxy)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(4-amino-2,5-difluorophenoxy)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578763 |
| Molecular Formula | C10H6F2IN3O2 |
| Molecular Weight | 365.08 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 4-(4-amino-2,5-difluorophenoxy)-5-iodo-1H-pyrimidin-6-one |
| SMILES | Nc1cc(F)c(Oc2nc[nH]c(=O)c2I)cc1F |
| InChI | InChI=1S/C10H6F2IN3O2/c11-4-2-7(5(12)1-6(4)14)18-10-8(13)9(17)15-3-16-10/h1-3H,14H2,(H,15,16,17) |
| InChIKey | JBBNARTWVUZLPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|