C11H10IN3O2 — CID 114252553
4-(3-amino-4-methylphenoxy)-5-iodo-1H-pyrimidin-6-one (PubChem CID 114252553) has the molecular formula C11H10IN3O2 and a molecular weight of 343.12 g/mol. Its IUPAC name is 4-(3-amino-4-methylphenoxy)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(3-amino-4-methylphenoxy)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114252553 |
| Molecular Formula | C11H10IN3O2 |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 4-(3-amino-4-methylphenoxy)-5-iodo-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2nc[nH]c(=O)c2I)cc1N |
| InChI | InChI=1S/C11H10IN3O2/c1-6-2-3-7(4-8(6)13)17-11-9(12)10(16)14-5-15-11/h2-5H,13H2,1H3,(H,14,15,16) |
| InChIKey | QEWLZRMERCNJDM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|