About 6-prop-2-enoxy-7H-purine
6-prop-2-enoxy-7H-purine (PubChem CID 3816971) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 6-prop-2-enoxy-7H-purine.
Molecular Properties
| Compound Name | 6-prop-2-enoxy-7H-purine |
| PubChem CID | 3816971 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-prop-2-enoxy-7H-purine |
| SMILES | C=CCOc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H8N4O/c1-2-3-13-8-6-7(10-4-9-6)11-5-12-8/h2,4-5H,1,3H2,(H,9,10,11,12) |
| InChIKey | KQTMKEHKXBCEMK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enoxy-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enoxy-7H-purine?
The IUPAC name of 6-prop-2-enoxy-7H-purine (CID 3816971) is 6-prop-2-enoxy-7H-purine.
What is the SMILES notation for 6-prop-2-enoxy-7H-purine?
The canonical SMILES for 6-prop-2-enoxy-7H-purine is C=CCOc1ncnc2nc[nH]c12.
What is the InChIKey of 6-prop-2-enoxy-7H-purine?
The InChIKey is KQTMKEHKXBCEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c1-2-3-13-8-6-7(10-4-9-6)11-5-12-8/h2,4-5H,1,3H2,(H,9,10,11,12).
What are the key properties of 6-prop-2-enoxy-7H-purine?
6-prop-2-enoxy-7H-purine has a molecular weight of 176.18 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enoxy-7H-purine is sourced from PubChem (CID 3816971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).