About 7H-purin-6-yl 2-aminoacetate
7H-purin-6-yl 2-aminoacetate (PubChem CID 54229916) has the molecular formula C7H7N5O2
and a molecular weight of 193.17 g/mol. Its IUPAC name is 7H-purin-6-yl 2-aminoacetate.
Molecular Properties
| Compound Name | 7H-purin-6-yl 2-aminoacetate |
| PubChem CID | 54229916 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 7H-purin-6-yl 2-aminoacetate |
| SMILES | NCC(=O)Oc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C7H7N5O2/c8-1-4(13)14-7-5-6(10-2-9-5)11-3-12-7/h2-3H,1,8H2,(H,9,10,11,12) |
| InChIKey | QINKQADWHLPPTG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7H-purin-6-yl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-6-yl 2-aminoacetate?
The IUPAC name of 7H-purin-6-yl 2-aminoacetate (CID 54229916) is 7H-purin-6-yl 2-aminoacetate.
What is the SMILES notation for 7H-purin-6-yl 2-aminoacetate?
The canonical SMILES for 7H-purin-6-yl 2-aminoacetate is NCC(=O)Oc1ncnc2nc[nH]c12.
What is the InChIKey of 7H-purin-6-yl 2-aminoacetate?
The InChIKey is QINKQADWHLPPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2/c8-1-4(13)14-7-5-6(10-2-9-5)11-3-12-7/h2-3H,1,8H2,(H,9,10,11,12).
What are the key properties of 7H-purin-6-yl 2-aminoacetate?
7H-purin-6-yl 2-aminoacetate has a molecular weight of 193.17 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-6-yl 2-aminoacetate is sourced from PubChem (CID 54229916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).