C11H7N5O3 — CID 61396179
3-(7H-purin-6-yloxy)pyridine-2-carboxylic acid (PubChem CID 61396179) has the molecular formula C11H7N5O3 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-(7H-purin-6-yloxy)pyridine-2-carboxylic acid.
| Compound Name | 3-(7H-purin-6-yloxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 61396179 |
| Molecular Formula | C11H7N5O3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-(7H-purin-6-yloxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncccc1Oc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H7N5O3/c17-11(18)7-6(2-1-3-12-7)19-10-8-9(14-4-13-8)15-5-16-10/h1-5H,(H,17,18)(H,13,14,15,16) |
| InChIKey | VHXYGLANPXDZLN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |