C13H12N6OS — CID 63357462
4-amino-N-methyl-3-(7H-purin-6-ylsulfanyl)benzamide (PubChem CID 63357462) has the molecular formula C13H12N6OS and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-amino-N-methyl-3-(7H-purin-6-ylsulfanyl)benzamide.
| Compound Name | 4-amino-N-methyl-3-(7H-purin-6-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 63357462 |
| Molecular Formula | C13H12N6OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-amino-N-methyl-3-(7H-purin-6-ylsulfanyl)benzamide |
| SMILES | CNC(=O)c1ccc(N)c(Sc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H12N6OS/c1-15-12(20)7-2-3-8(14)9(4-7)21-13-10-11(17-5-16-10)18-6-19-13/h2-6H,14H2,1H3,(H,15,20)(H,16,17,18,19) |
| InChIKey | BMBHOBMIQFDXFA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|