C14H14BrN5S — CID 82954356
1-[4-bromo-2-(7H-purin-6-ylsulfanyl)phenyl]-N-methylethanamine (PubChem CID 82954356) has the molecular formula C14H14BrN5S and a molecular weight of 364.27 g/mol. Its IUPAC name is 1-[4-bromo-2-(7H-purin-6-ylsulfanyl)phenyl]-N-methylethanamine.
| Compound Name | 1-[4-bromo-2-(7H-purin-6-ylsulfanyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 82954356 |
| Molecular Formula | C14H14BrN5S |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-[4-bromo-2-(7H-purin-6-ylsulfanyl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(Br)cc1Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H14BrN5S/c1-8(16-2)10-4-3-9(15)5-11(10)21-14-12-13(18-6-17-12)19-7-20-14/h3-8,16H,1-2H3,(H,17,18,19,20) |
| InChIKey | LFFTZDOANJCBII-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |